C24H23N3O6S — CID 87141806
(3S)-3-(1,3-benzodioxol-5-yl)-3-[[2-oxo-1-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethyl]-3-pyridinyl]carbamoylamino]propanoic acid (PubChem CID 87141806) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-3-[[2-oxo-1-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethyl]-3-pyridinyl]carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[2-oxo-1-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethyl]-3-pyridinyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 87141806 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-3-[[2-oxo-1-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethyl]-3-pyridinyl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)Nc1cccn(CCC2=CC=CCC2=S)c1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N3O6S/c28-22(29)13-18(16-7-8-19-20(12-16)33-14-32-19)26-24(31)25-17-5-3-10-27(23(17)30)11-9-15-4-1-2-6-21(15)34/h1-5,7-8,10,12,18H,6,9,11,13-14H2,(H,28,29)(H2,25,26,31)/t18-/m0/s1 |
| InChIKey | RMVZFWIJMYGEQC-SFHVURJKSA-N |
| XLogP | 3.56 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|