C24H25N3O6S — CID 91242911
(3S)-3-(3,5-dimethoxyphenyl)-3-[[2-oxo-1-[(2-sulfanylphenyl)methyl]-3-pyridinyl]carbamoylamino]propanoic acid (PubChem CID 91242911) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is (3S)-3-(3,5-dimethoxyphenyl)-3-[[2-oxo-1-[(2-sulfanylphenyl)methyl]-3-pyridinyl]carbamoylamino]propanoic acid.
| Compound Name | (3S)-3-(3,5-dimethoxyphenyl)-3-[[2-oxo-1-[(2-sulfanylphenyl)methyl]-3-pyridinyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 91242911 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (3S)-3-(3,5-dimethoxyphenyl)-3-[[2-oxo-1-[(2-sulfanylphenyl)methyl]-3-pyridinyl]carbamoylamino]propanoic acid |
| SMILES | COc1cc(OC)cc([C@H](CC(=O)O)NC(=O)Nc2cccn(Cc3ccccc3S)c2=O)c1 |
| InChI | InChI=1S/C24H25N3O6S/c1-32-17-10-16(11-18(12-17)33-2)20(13-22(28)29)26-24(31)25-19-7-5-9-27(23(19)30)14-15-6-3-4-8-21(15)34/h3-12,20,34H,13-14H2,1-2H3,(H,28,29)(H2,25,26,31)/t20-/m0/s1 |
| InChIKey | UJHNEMGVRZJTJK-FQEVSTJZSA-N |
| XLogP | 3.54 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|