C23H20F3N3O4S — CID 87141900
(3S)-3-[[2-oxo-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3-pyridinyl]carbamoylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 87141900) has the molecular formula C23H20F3N3O4S and a molecular weight of 491.49 g/mol. Its IUPAC name is (3S)-3-[[2-oxo-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3-pyridinyl]carbamoylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (3S)-3-[[2-oxo-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3-pyridinyl]carbamoylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 87141900 |
| Molecular Formula | C23H20F3N3O4S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | (3S)-3-[[2-oxo-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3-pyridinyl]carbamoylamino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)Nc1cccn(CC2=CC=CCC2=S)c1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3N3O4S/c24-23(25,26)16-7-3-6-14(11-16)18(12-20(30)31)28-22(33)27-17-8-4-10-29(21(17)32)13-15-5-1-2-9-19(15)34/h1-8,10-11,18H,9,12-13H2,(H,30,31)(H2,27,28,33)/t18-/m0/s1 |
| InChIKey | YGEOWBFVGVEHGG-SFHVURJKSA-N |
| XLogP | 4.46 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|