C16H13ClF4N2O2 — CID 166264320
1-(3-chloro-2-fluorophenyl)-3-[2-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 166264320) has the molecular formula C16H13ClF4N2O2 and a molecular weight of 376.74 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-[2-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-[2-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 166264320 |
| Molecular Formula | C16H13ClF4N2O2 |
| Molecular Weight | 376.74 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-[2-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1F)NC(CO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13ClF4N2O2/c17-11-5-2-6-12(14(11)18)22-15(25)23-13(8-24)9-3-1-4-10(7-9)16(19,20)21/h1-7,13,24H,8H2,(H2,22,23,25) |
| InChIKey | XJYZUOBMDOHJMM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |