C20H21NO2 — CID 8714203
(E)-N-(2,3-dimethylphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 8714203) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (E)-N-(2,3-dimethylphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,3-dimethylphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8714203 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (E)-N-(2,3-dimethylphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-4-14-23-18-11-8-17(9-12-18)10-13-20(22)21-19-7-5-6-15(2)16(19)3/h4-13H,1,14H2,2-3H3,(H,21,22)/b13-10+ |
| InChIKey | IUUQICAFPJNXIG-JLHYYAGUSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|