ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid

C14H14O7S2 — CID 87145294

IUPACethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid
SMILESC=C.O=C(c1ccc2ccccc2c1)C(S(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C12H10O7S2.C2H4/c13-11(12(20(14,15)16)21(17,18)19)10-6-5-8-3-1-2-4-9(8)7-10;1-2/h1-7,12H,(H,14,15,16)(H,17,18,19);1-2H2
InChIKeySOYVIRRTMZULID-UHFFFAOYSA-N
MW358.39 g/mol
LogP1.93
Rot. Bonds4

About ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid

ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid (PubChem CID 87145294) has the molecular formula C14H14O7S2 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid.

Molecular Properties

Compound Nameethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid
PubChem CID87145294
Molecular FormulaC14H14O7S2
Molecular Weight358.39 g/mol
Exact Mass358.02
IUPAC Nameethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid
SMILESC=C.O=C(c1ccc2ccccc2c1)C(S(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C12H10O7S2.C2H4/c13-11(12(20(14,15)16)21(17,18)19)10-6-5-8-3-1-2-4-9(8)7-10;1-2/h1-7,12H,(H,14,15,16)(H,17,18,19);1-2H2
InChIKeySOYVIRRTMZULID-UHFFFAOYSA-N
XLogP1.93
TPSA125.81 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.39
LogP ≤ 51.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid?
The IUPAC name of ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid (CID 87145294) is ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid.
What is the SMILES notation for ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid?
The canonical SMILES for ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid is C=C.O=C(c1ccc2ccccc2c1)C(S(=O)(=O)O)S(=O)(=O)O.
What is the InChIKey of ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid?
The InChIKey is SOYVIRRTMZULID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O7S2.C2H4/c13-11(12(20(14,15)16)21(17,18)19)10-6-5-8-3-1-2-4-9(8)7-10;1-2/h1-7,12H,(H,14,15,16)(H,17,18,19);1-2H2.
What are the key properties of ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid?
ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid has a molecular weight of 358.39 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-naphthalen-2-yl-2-oxoethane-1,1-disulfonic acid is sourced from PubChem (CID 87145294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).