C8H18N2O — CID 87149989
(2S)-2-(dimethylamino)-3,3-dimethylbutanamide (PubChem CID 87149989) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-(dimethylamino)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 87149989 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (2S)-2-(dimethylamino)-3,3-dimethylbutanamide |
| SMILES | CN(C)[C@H](C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C8H18N2O/c1-8(2,3)6(7(9)11)10(4)5/h6H,1-5H3,(H2,9,11)/t6-/m1/s1 |
| InChIKey | YZZDVCGDIVDQLO-ZCFIWIBFSA-N |
| XLogP | 0.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |