C13H29N3O2 — CID 174612648
N,N-dimethylmethanamine;2,3-di(propan-2-yl)butanediamide (PubChem CID 174612648) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2,3-di(propan-2-yl)butanediamide.
| Compound Name | N,N-dimethylmethanamine;2,3-di(propan-2-yl)butanediamide |
|---|---|
| PubChem CID | 174612648 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N,N-dimethylmethanamine;2,3-di(propan-2-yl)butanediamide |
| SMILES | CC(C)C(C(N)=O)C(C(N)=O)C(C)C.CN(C)C |
| InChI | InChI=1S/C10H20N2O2.C3H9N/c1-5(2)7(9(11)13)8(6(3)4)10(12)14;1-4(2)3/h5-8H,1-4H3,(H2,11,13)(H2,12,14);1-3H3 |
| InChIKey | TWDMUSMVTLVBRH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |