C17H13N3O2S2 — CID 87152416
methyl N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-N-sulfanylcarbamate (PubChem CID 87152416) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-N-sulfanylcarbamate.
| Compound Name | methyl N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-N-sulfanylcarbamate |
|---|---|
| PubChem CID | 87152416 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | methyl N-[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]-N-sulfanylcarbamate |
| SMILES | COC(=O)N(S)c1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C17H13N3O2S2/c1-22-17(21)20(23)12-6-11-9-18-19-16(11)13(8-12)15-7-10-4-2-3-5-14(10)24-15/h2-9,23H,1H3,(H,18,19) |
| InChIKey | PUBHIRIZLRQYIL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|