C23H15N5OS — CID 59024311
7-(1-benzothiophen-2-yl)-N-(1H-indazol-6-yl)-1H-indazole-5-carboxamide (PubChem CID 59024311) has the molecular formula C23H15N5OS and a molecular weight of 409.47 g/mol. Its IUPAC name is 7-(1-benzothiophen-2-yl)-N-(1H-indazol-6-yl)-1H-indazole-5-carboxamide.
| Compound Name | 7-(1-benzothiophen-2-yl)-N-(1H-indazol-6-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 59024311 |
| Molecular Formula | C23H15N5OS |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 7-(1-benzothiophen-2-yl)-N-(1H-indazol-6-yl)-1H-indazole-5-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)c1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C23H15N5OS/c29-23(26-17-6-5-14-11-24-27-19(14)10-17)15-7-16-12-25-28-22(16)18(8-15)21-9-13-3-1-2-4-20(13)30-21/h1-12H,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | ASRWMMXYJMCAMM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |