C25H17N5O2S — CID 91350780
7-(1-benzothiophen-2-yl)-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)-1H-indazole-5-carboxamide (PubChem CID 91350780) has the molecular formula C25H17N5O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is 7-(1-benzothiophen-2-yl)-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)-1H-indazole-5-carboxamide.
| Compound Name | 7-(1-benzothiophen-2-yl)-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91350780 |
| Molecular Formula | C25H17N5O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 7-(1-benzothiophen-2-yl)-N-(3-oxo-2-phenyl-1H-pyrazol-5-yl)-1H-indazole-5-carboxamide |
| SMILES | O=C(Nc1cc(=O)n(-c2ccccc2)[nH]1)c1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C25H17N5O2S/c31-23-13-22(29-30(23)18-7-2-1-3-8-18)27-25(32)16-10-17-14-26-28-24(17)19(11-16)21-12-15-6-4-5-9-20(15)33-21/h1-14,29H,(H,26,28)(H,27,32) |
| InChIKey | CHIZFRQMISWHGP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |