About acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide
acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide (PubChem CID 162330115) has the molecular formula C23H22N4O4S
and a molecular weight of 450.52 g/mol. Its IUPAC name is acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide.
Molecular Properties
| Compound Name | acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide |
| PubChem CID | 162330115 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide |
| SMILES | CC(=O)O.O=C1CCC(NC(=O)c2cc(-c3cc4ccccc4s3)c3[nH]ncc3c2)CN1 |
| InChI | InChI=1S/C21H18N4O2S.C2H4O2/c26-19-6-5-15(11-22-19)24-21(27)13-7-14-10-23-25-20(14)16(8-13)18-9-12-3-1-2-4-17(12)28-18;1-2(3)4/h1-4,7-10,15H,5-6,11H2,(H,22,26)(H,23,25)(H,24,27);1H3,(H,3,4) |
| InChIKey | YDUJBPCVPRVAQV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide?
The IUPAC name of acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide (CID 162330115) is acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide.
What is the SMILES notation for acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide?
The canonical SMILES for acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide is CC(=O)O.O=C1CCC(NC(=O)c2cc(-c3cc4ccccc4s3)c3[nH]ncc3c2)CN1.
What is the InChIKey of acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide?
The InChIKey is YDUJBPCVPRVAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O2S.C2H4O2/c26-19-6-5-15(11-22-19)24-21(27)13-7-14-10-23-25-20(14)16(8-13)18-9-12-3-1-2-4-17(12)28-18;1-2(3)4/h1-4,7-10,15H,5-6,11H2,(H,22,26)(H,23,25)(H,24,27);1H3,(H,3,4).
What are the key properties of acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide?
acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide has a molecular weight of 450.52 g/mol, XLogP of 3.54, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;7-(1-benzothiophen-2-yl)-N-(6-oxopiperidin-3-yl)-1H-indazole-5-carboxamide is sourced from PubChem (CID 162330115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).