C24H16N4OS — CID 147160112
7-(1-benzothiophen-2-yl)-N-(1H-indazol-5-yl)-1H-isoindole-5-carboxamide (PubChem CID 147160112) has the molecular formula C24H16N4OS and a molecular weight of 408.49 g/mol. Its IUPAC name is 7-(1-benzothiophen-2-yl)-N-(1H-indazol-5-yl)-1H-isoindole-5-carboxamide.
| Compound Name | 7-(1-benzothiophen-2-yl)-N-(1H-indazol-5-yl)-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 147160112 |
| Molecular Formula | C24H16N4OS |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 7-(1-benzothiophen-2-yl)-N-(1H-indazol-5-yl)-1H-isoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)c1cc2c(c(-c3cc4ccccc4s3)c1)CN=C2 |
| InChI | InChI=1S/C24H16N4OS/c29-24(27-18-5-6-21-17(8-18)12-26-28-21)15-7-16-11-25-13-20(16)19(9-15)23-10-14-3-1-2-4-22(14)30-23/h1-12H,13H2,(H,26,28)(H,27,29) |
| InChIKey | BVRBENJTNRZVLS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |