C37H26N4O2S2 — CID 160558098
7-(1-benzothiophen-2-yl)-1H-isoindol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-isoindol-5-yl]furan-2-carboxamide (PubChem CID 160558098) has the molecular formula C37H26N4O2S2 and a molecular weight of 622.78 g/mol. Its IUPAC name is 7-(1-benzothiophen-2-yl)-1H-isoindol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-isoindol-5-yl]furan-2-carboxamide.
| Compound Name | 7-(1-benzothiophen-2-yl)-1H-isoindol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-isoindol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 160558098 |
| Molecular Formula | C37H26N4O2S2 |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 7-(1-benzothiophen-2-yl)-1H-isoindol-5-amine;N-[7-(1-benzothiophen-2-yl)-1H-isoindol-5-yl]furan-2-carboxamide |
| SMILES | Nc1cc2c(c(-c3cc4ccccc4s3)c1)CN=C2.O=C(Nc1cc2c(c(-c3cc4ccccc4s3)c1)CN=C2)c1ccco1 |
| InChI | InChI=1S/C21H14N2O2S.C16H12N2S/c24-21(18-5-3-7-25-18)23-15-8-14-11-22-12-17(14)16(10-15)20-9-13-4-1-2-6-19(13)26-20;17-12-5-11-8-18-9-14(11)13(7-12)16-6-10-3-1-2-4-15(10)19-16/h1-11H,12H2,(H,23,24);1-8H,9,17H2 |
| InChIKey | QYYKNRICBYWLHE-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|