C12H9ClN4O2S — CID 91680643
N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)furan-2-carboxamide (PubChem CID 91680643) has the molecular formula C12H9ClN4O2S and a molecular weight of 308.75 g/mol. Its IUPAC name is N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)furan-2-carboxamide.
| Compound Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91680643 |
| Molecular Formula | C12H9ClN4O2S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)furan-2-carboxamide |
| SMILES | NNc1nc2c(Cl)cc(NC(=O)c3ccco3)cc2s1 |
| InChI | InChI=1S/C12H9ClN4O2S/c13-7-4-6(15-11(18)8-2-1-3-19-8)5-9-10(7)16-12(17-14)20-9/h1-5H,14H2,(H,15,18)(H,16,17) |
| InChIKey | ACMOJRTYSYUUGZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|