C15H13ClN4OS — CID 91680436
N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3-methylbenzamide (PubChem CID 91680436) has the molecular formula C15H13ClN4OS and a molecular weight of 332.82 g/mol. Its IUPAC name is N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3-methylbenzamide.
| Compound Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 91680436 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(Cl)c3nc(NN)sc3c2)c1 |
| InChI | InChI=1S/C15H13ClN4OS/c1-8-3-2-4-9(5-8)14(21)18-10-6-11(16)13-12(7-10)22-15(19-13)20-17/h2-7H,17H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | PNMHLSNNDUOECR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|