C14H10BrClN4OS — CID 91680524
4-bromo-N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 91680524) has the molecular formula C14H10BrClN4OS and a molecular weight of 397.69 g/mol. Its IUPAC name is 4-bromo-N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 4-bromo-N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 91680524 |
| Molecular Formula | C14H10BrClN4OS |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | 4-bromo-N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | NNc1nc2c(Cl)cc(NC(=O)c3ccc(Br)cc3)cc2s1 |
| InChI | InChI=1S/C14H10BrClN4OS/c15-8-3-1-7(2-4-8)13(21)18-9-5-10(16)12-11(6-9)22-14(19-12)20-17/h1-6H,17H2,(H,18,21)(H,19,20) |
| InChIKey | QAJUHGUIIHKYIG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|