C20H15BrN4OS — CID 91680445
N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-4-phenylbenzamide (PubChem CID 91680445) has the molecular formula C20H15BrN4OS and a molecular weight of 439.34 g/mol. Its IUPAC name is N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-4-phenylbenzamide.
| Compound Name | N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 91680445 |
| Molecular Formula | C20H15BrN4OS |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-4-phenylbenzamide |
| SMILES | NNc1nc2c(Br)cc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2s1 |
| InChI | InChI=1S/C20H15BrN4OS/c21-16-10-15(11-17-18(16)24-20(25-22)27-17)23-19(26)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,22H2,(H,23,26)(H,24,25) |
| InChIKey | JXJFAFQCZBCGRL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|