C15H11BrCl2N4O2S — CID 91680670
N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,5-dichloro-4-methoxybenzamide (PubChem CID 91680670) has the molecular formula C15H11BrCl2N4O2S and a molecular weight of 462.16 g/mol. Its IUPAC name is N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,5-dichloro-4-methoxybenzamide.
| Compound Name | N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,5-dichloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 91680670 |
| Molecular Formula | C15H11BrCl2N4O2S |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | N-(4-bromo-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,5-dichloro-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2cc(Br)c3nc(NN)sc3c2)cc1Cl |
| InChI | InChI=1S/C15H11BrCl2N4O2S/c1-24-13-9(17)2-6(3-10(13)18)14(23)20-7-4-8(16)12-11(5-7)25-15(21-12)22-19/h2-5H,19H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YFGSZFBUVSJGDV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|