C17H17ClN4O4S — CID 91680619
N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,4,5-trimethoxybenzamide (PubChem CID 91680619) has the molecular formula C17H17ClN4O4S and a molecular weight of 408.87 g/mol. Its IUPAC name is N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 91680619 |
| Molecular Formula | C17H17ClN4O4S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(4-chloro-2-hydrazinyl-1,3-benzothiazol-6-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(Cl)c3nc(NN)sc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17ClN4O4S/c1-24-11-4-8(5-12(25-2)15(11)26-3)16(23)20-9-6-10(18)14-13(7-9)27-17(21-14)22-19/h4-7H,19H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | ZWVDHPSZRKAZHG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|