C22H16N4O3S — CID 59023823
N-[2-[[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 59023823) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[2-[[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59023823 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[2-[[7-(1-benzothiophen-2-yl)-1H-indazol-5-yl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)Nc1cc(-c2cc3ccccc3s2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C22H16N4O3S/c27-20(12-23-22(28)17-5-3-7-29-17)25-15-8-14-11-24-26-21(14)16(10-15)19-9-13-4-1-2-6-18(13)30-19/h1-11H,12H2,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | VOFHOJJZMHEDBN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |