C10H10N4O2 — CID 110178922
N-(2,6-diamino-3-pyridinyl)furan-2-carboxamide (PubChem CID 110178922) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-(2,6-diamino-3-pyridinyl)furan-2-carboxamide.
| Compound Name | N-(2,6-diamino-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110178922 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-(2,6-diamino-3-pyridinyl)furan-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2ccco2)c(N)n1 |
| InChI | InChI=1S/C10H10N4O2/c11-8-4-3-6(9(12)14-8)13-10(15)7-2-1-5-16-7/h1-5H,(H,13,15)(H4,11,12,14) |
| InChIKey | TWORIDRVTILLGV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |