C22H29O4P — CID 87155053
bis(cyclohex-3-en-1-ylmethoxy)phosphoryl-(2-methylphenyl)methanone (PubChem CID 87155053) has the molecular formula C22H29O4P and a molecular weight of 388.44 g/mol. Its IUPAC name is bis(cyclohex-3-en-1-ylmethoxy)phosphoryl-(2-methylphenyl)methanone.
| Compound Name | bis(cyclohex-3-en-1-ylmethoxy)phosphoryl-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 87155053 |
| Molecular Formula | C22H29O4P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | bis(cyclohex-3-en-1-ylmethoxy)phosphoryl-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)P(=O)(OCC1CC=CCC1)OCC1CC=CCC1 |
| InChI | InChI=1S/C22H29O4P/c1-18-10-8-9-15-21(18)22(23)27(24,25-16-19-11-4-2-5-12-19)26-17-20-13-6-3-7-14-20/h2-4,6,8-10,15,19-20H,5,7,11-14,16-17H2,1H3 |
| InChIKey | PKVHDMOXFNCTJN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|