C21H29O4P — CID 141187341
bis(cyclohex-3-en-1-ylmethyl) (4-methylphenyl) phosphate (PubChem CID 141187341) has the molecular formula C21H29O4P and a molecular weight of 376.43 g/mol. Its IUPAC name is bis(cyclohex-3-en-1-ylmethyl) (4-methylphenyl) phosphate.
| Compound Name | bis(cyclohex-3-en-1-ylmethyl) (4-methylphenyl) phosphate |
|---|---|
| PubChem CID | 141187341 |
| Molecular Formula | C21H29O4P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | bis(cyclohex-3-en-1-ylmethyl) (4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(OCC2CC=CCC2)OCC2CC=CCC2)cc1 |
| InChI | InChI=1S/C21H29O4P/c1-18-12-14-21(15-13-18)25-26(22,23-16-19-8-4-2-5-9-19)24-17-20-10-6-3-7-11-20/h2-4,6,12-15,19-20H,5,7-11,16-17H2,1H3 |
| InChIKey | ZGZXAPAZIQVBIF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|