C25H22Cl3F3N6O4 — CID 87160646
2-[[2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]acetyl]amino]-2-(2,3-dichlorophenyl)acetyl]amino]-2-methylpropanamide (PubChem CID 87160646) has the molecular formula C25H22Cl3F3N6O4 and a molecular weight of 633.84 g/mol. Its IUPAC name is 2-[[2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]acetyl]amino]-2-(2,3-dichlorophenyl)acetyl]amino]-2-methylpropanamide.
| Compound Name | 2-[[2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]acetyl]amino]-2-(2,3-dichlorophenyl)acetyl]amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 87160646 |
| Molecular Formula | C25H22Cl3F3N6O4 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | 2-[[2-[[2-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]acetyl]amino]-2-(2,3-dichlorophenyl)acetyl]amino]-2-methylpropanamide |
| SMILES | CC(C)(NC(=O)C(NC(=O)Cn1nc(-c2ccc(Cl)cc2)n(/C=C/C(F)(F)F)c1=O)c1cccc(Cl)c1Cl)C(N)=O |
| InChI | InChI=1S/C25H22Cl3F3N6O4/c1-24(2,22(32)40)34-21(39)19(15-4-3-5-16(27)18(15)28)33-17(38)12-37-23(41)36(11-10-25(29,30)31)20(35-37)13-6-8-14(26)9-7-13/h3-11,19H,12H2,1-2H3,(H2,32,40)(H,33,38)(H,34,39)/b11-10+ |
| InChIKey | ZVLWSPQHPJGEPT-ZHACJKMWSA-N |
| XLogP | 3.94 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |