C26H23Cl3F3N5O4 — CID 157363028
N-(1-amino-2-methyl-1-oxopropan-2-yl)-5-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]-2-(2,3-dichlorophenyl)-4-oxopentanamide (PubChem CID 157363028) has the molecular formula C26H23Cl3F3N5O4 and a molecular weight of 632.85 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-oxopropan-2-yl)-5-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]-2-(2,3-dichlorophenyl)-4-oxopentanamide.
| Compound Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-5-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]-2-(2,3-dichlorophenyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 157363028 |
| Molecular Formula | C26H23Cl3F3N5O4 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | N-(1-amino-2-methyl-1-oxopropan-2-yl)-5-[3-(4-chlorophenyl)-5-oxo-4-[(E)-3,3,3-trifluoroprop-1-enyl]-1,2,4-triazol-1-yl]-2-(2,3-dichlorophenyl)-4-oxopentanamide |
| SMILES | CC(C)(NC(=O)C(CC(=O)Cn1nc(-c2ccc(Cl)cc2)n(/C=C/C(F)(F)F)c1=O)c1cccc(Cl)c1Cl)C(N)=O |
| InChI | InChI=1S/C26H23Cl3F3N5O4/c1-25(2,23(33)40)34-22(39)18(17-4-3-5-19(28)20(17)29)12-16(38)13-37-24(41)36(11-10-26(30,31)32)21(35-37)14-6-8-15(27)9-7-14/h3-11,18H,12-13H2,1-2H3,(H2,33,40)(H,34,39)/b11-10+ |
| InChIKey | BIVYRMJRYSCWMC-ZHACJKMWSA-N |
| XLogP | 4.83 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |