About N'-(1-aminopropyl)butane-1,4-diamine
N'-(1-aminopropyl)butane-1,4-diamine (PubChem CID 87162705) has the molecular formula C7H19N3
and a molecular weight of 145.25 g/mol. Its IUPAC name is N'-(1-aminopropyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(1-aminopropyl)butane-1,4-diamine |
| PubChem CID | 87162705 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | N'-(1-aminopropyl)butane-1,4-diamine |
| SMILES | CCC(N)NCCCCN |
| InChI | InChI=1S/C7H19N3/c1-2-7(9)10-6-4-3-5-8/h7,10H,2-6,8-9H2,1H3 |
| InChIKey | LVLIMOFASWZMLG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-aminopropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-aminopropyl)butane-1,4-diamine?
The IUPAC name of N'-(1-aminopropyl)butane-1,4-diamine (CID 87162705) is N'-(1-aminopropyl)butane-1,4-diamine.
What is the SMILES notation for N'-(1-aminopropyl)butane-1,4-diamine?
The canonical SMILES for N'-(1-aminopropyl)butane-1,4-diamine is CCC(N)NCCCCN.
What is the InChIKey of N'-(1-aminopropyl)butane-1,4-diamine?
The InChIKey is LVLIMOFASWZMLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19N3/c1-2-7(9)10-6-4-3-5-8/h7,10H,2-6,8-9H2,1H3.
What are the key properties of N'-(1-aminopropyl)butane-1,4-diamine?
N'-(1-aminopropyl)butane-1,4-diamine has a molecular weight of 145.25 g/mol, XLogP of 0.01, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-aminopropyl)butane-1,4-diamine is sourced from PubChem (CID 87162705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).