About sodium dioctylazanide
sodium dioctylazanide (PubChem CID 87162823) has the molecular formula C16H34NNa
and a molecular weight of 263.44 g/mol. Its IUPAC name is sodium dioctylazanide.
Molecular Properties
| Compound Name | sodium dioctylazanide |
| PubChem CID | 87162823 |
| Molecular Formula | C16H34NNa |
| Molecular Weight | 263.44 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | sodium dioctylazanide |
| SMILES | CCCCCCCC[N-]CCCCCCCC.[Na+] |
| InChI | InChI=1S/C16H34N.Na/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3;/q-1;+1 |
| InChIKey | YSBNGHIFSHSKTO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium dioctylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dioctylazanide?
The IUPAC name of sodium dioctylazanide (CID 87162823) is sodium dioctylazanide.
What is the SMILES notation for sodium dioctylazanide?
The canonical SMILES for sodium dioctylazanide is CCCCCCCC[N-]CCCCCCCC.[Na+].
What is the InChIKey of sodium dioctylazanide?
The InChIKey is YSBNGHIFSHSKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N.Na/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3;/q-1;+1.
What are the key properties of sodium dioctylazanide?
sodium dioctylazanide has a molecular weight of 263.44 g/mol, XLogP of 3.09, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dioctylazanide is sourced from PubChem (CID 87162823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).