About chlorotitanium(1+);dioctylazanide
chlorotitanium(1+);dioctylazanide (PubChem CID 174285151) has the molecular formula C16H34ClNTi
and a molecular weight of 323.78 g/mol. Its IUPAC name is chlorotitanium(1+);dioctylazanide.
Molecular Properties
| Compound Name | chlorotitanium(1+);dioctylazanide |
| PubChem CID | 174285151 |
| Molecular Formula | C16H34ClNTi |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | chlorotitanium(1+);dioctylazanide |
| SMILES | CCCCCCCC[N-]CCCCCCCC.Cl[Ti+] |
| InChI | InChI=1S/C16H34N.ClH.Ti/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;;/h3-16H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | RTQLCIMMHDRGKN-UHFFFAOYSA-M |
| XLogP | 6.77 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze chlorotitanium(1+);dioctylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorotitanium(1+);dioctylazanide?
The IUPAC name of chlorotitanium(1+);dioctylazanide (CID 174285151) is chlorotitanium(1+);dioctylazanide.
What is the SMILES notation for chlorotitanium(1+);dioctylazanide?
The canonical SMILES for chlorotitanium(1+);dioctylazanide is CCCCCCCC[N-]CCCCCCCC.Cl[Ti+].
What is the InChIKey of chlorotitanium(1+);dioctylazanide?
The InChIKey is RTQLCIMMHDRGKN-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H34N.ClH.Ti/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;;/h3-16H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of chlorotitanium(1+);dioctylazanide?
chlorotitanium(1+);dioctylazanide has a molecular weight of 323.78 g/mol, XLogP of 6.77, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorotitanium(1+);dioctylazanide is sourced from PubChem (CID 174285151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).