About bis(dibutylazanide);dichlorotitanium
bis(dibutylazanide);dichlorotitanium (PubChem CID 87309711) has the molecular formula C16H36Cl2N2Ti-2
and a molecular weight of 375.25 g/mol. Its IUPAC name is bis(dibutylazanide);dichlorotitanium.
Molecular Properties
| Compound Name | bis(dibutylazanide);dichlorotitanium |
| PubChem CID | 87309711 |
| Molecular Formula | C16H36Cl2N2Ti-2 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | bis(dibutylazanide);dichlorotitanium |
| SMILES | CCCC[N-]CCCC.CCCC[N-]CCCC.Cl[Ti]Cl |
| InChI | InChI=1S/2C8H18N.2ClH.Ti/c2*1-3-5-7-9-8-6-4-2;;;/h2*3-8H2,1-2H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | HSGSIQJMKWPAGZ-UHFFFAOYSA-L |
| XLogP | 7.30 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(dibutylazanide);dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dibutylazanide);dichlorotitanium?
The IUPAC name of bis(dibutylazanide);dichlorotitanium (CID 87309711) is bis(dibutylazanide);dichlorotitanium.
What is the SMILES notation for bis(dibutylazanide);dichlorotitanium?
The canonical SMILES for bis(dibutylazanide);dichlorotitanium is CCCC[N-]CCCC.CCCC[N-]CCCC.Cl[Ti]Cl.
What is the InChIKey of bis(dibutylazanide);dichlorotitanium?
The InChIKey is HSGSIQJMKWPAGZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H18N.2ClH.Ti/c2*1-3-5-7-9-8-6-4-2;;;/h2*3-8H2,1-2H3;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of bis(dibutylazanide);dichlorotitanium?
bis(dibutylazanide);dichlorotitanium has a molecular weight of 375.25 g/mol, XLogP of 7.30, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dibutylazanide);dichlorotitanium is sourced from PubChem (CID 87309711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).