About butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium
butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium (PubChem CID 59057451) has the molecular formula C7H17Cl2NSiTi-2
and a molecular weight of 262.08 g/mol. Its IUPAC name is butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium.
Molecular Properties
| Compound Name | butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium |
| PubChem CID | 59057451 |
| Molecular Formula | C7H17Cl2NSiTi-2 |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium |
| SMILES | Cl[Ti]Cl.[CH2-][Si](C)(C)[N-]CCCC |
| InChI | InChI=1S/C7H17NSi.2ClH.Ti/c1-5-6-7-8-9(2,3)4;;;/h2,5-7H2,1,3-4H3;2*1H;/q-2;;;+2/p-2 |
| InChIKey | WSSBRXRHUZKMMQ-UHFFFAOYSA-L |
| XLogP | 4.12 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium?
The IUPAC name of butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium (CID 59057451) is butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium.
What is the SMILES notation for butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium?
The canonical SMILES for butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium is Cl[Ti]Cl.[CH2-][Si](C)(C)[N-]CCCC.
What is the InChIKey of butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium?
The InChIKey is WSSBRXRHUZKMMQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H17NSi.2ClH.Ti/c1-5-6-7-8-9(2,3)4;;;/h2,5-7H2,1,3-4H3;2*1H;/q-2;;;+2/p-2.
What are the key properties of butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium?
butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium has a molecular weight of 262.08 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[methanidyl(dimethyl)silyl]azanide;dichlorotitanium is sourced from PubChem (CID 59057451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).