C13H25ClO2 — CID 87163132
2-(ethoxymethyl)-3,3-dimethyl-2-propan-2-ylpentanoyl chloride (PubChem CID 87163132) has the molecular formula C13H25ClO2 and a molecular weight of 248.79 g/mol. Its IUPAC name is 2-(ethoxymethyl)-3,3-dimethyl-2-propan-2-ylpentanoyl chloride.
| Compound Name | 2-(ethoxymethyl)-3,3-dimethyl-2-propan-2-ylpentanoyl chloride |
|---|---|
| PubChem CID | 87163132 |
| Molecular Formula | C13H25ClO2 |
| Molecular Weight | 248.79 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-(ethoxymethyl)-3,3-dimethyl-2-propan-2-ylpentanoyl chloride |
| SMILES | CCOCC(C(=O)Cl)(C(C)C)C(C)(C)CC |
| InChI | InChI=1S/C13H25ClO2/c1-7-12(5,6)13(10(3)4,11(14)15)9-16-8-2/h10H,7-9H2,1-6H3 |
| InChIKey | MSKOZVSTSFKSBX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|