C10H21O4P — CID 87163824
5,5-dimethyl-2-(1-propoxyethyl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 87163824) has the molecular formula C10H21O4P and a molecular weight of 236.25 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1-propoxyethyl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 5,5-dimethyl-2-(1-propoxyethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 87163824 |
| Molecular Formula | C10H21O4P |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5,5-dimethyl-2-(1-propoxyethyl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCCOC(C)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C10H21O4P/c1-5-6-12-9(2)15(11)13-7-10(3,4)8-14-15/h9H,5-8H2,1-4H3 |
| InChIKey | IWQZZKGJCANXFW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|