C10H8O6 — CID 87163851
6-formyl-1,3-dioxo-4,5,6,7-tetrahydro-2-benzofuran-5-carboxylic acid (PubChem CID 87163851) has the molecular formula C10H8O6 and a molecular weight of 224.17 g/mol. Its IUPAC name is 6-formyl-1,3-dioxo-4,5,6,7-tetrahydro-2-benzofuran-5-carboxylic acid.
| Compound Name | 6-formyl-1,3-dioxo-4,5,6,7-tetrahydro-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 87163851 |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 6-formyl-1,3-dioxo-4,5,6,7-tetrahydro-2-benzofuran-5-carboxylic acid |
| SMILES | O=CC1CC2=C(CC1C(=O)O)C(=O)OC2=O |
| InChI | InChI=1S/C10H8O6/c11-3-4-1-6-7(2-5(4)8(12)13)10(15)16-9(6)14/h3-5H,1-2H2,(H,12,13) |
| InChIKey | PLBBKUWTVFPCTA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|