C14H26N4O12P2 — CID 87166101
[1-[4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]-2-(trimethylazaniumyl)ethyl] phosphono phosphate (PubChem CID 87166101) has the molecular formula C14H26N4O12P2 and a molecular weight of 504.33 g/mol. Its IUPAC name is [1-[4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]-2-(trimethylazaniumyl)ethyl] phosphono phosphate.
| Compound Name | [1-[4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]-2-(trimethylazaniumyl)ethyl] phosphono phosphate |
|---|---|
| PubChem CID | 87166101 |
| Molecular Formula | C14H26N4O12P2 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [1-[4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]-2-(trimethylazaniumyl)ethyl] phosphono phosphate |
| SMILES | C[N+](C)(C)CC(OP(=O)([O-])OP(=O)(O)O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C14H26N4O12P2/c1-18(2,3)5-8(29-32(26,27)30-31(23,24)25)7-4-17(14(22)16-12(7)15)13-11(21)10(20)9(6-19)28-13/h4,8-11,13,19-21H,5-6H2,1-3H3,(H4-,15,16,22,23,24,25,26,27)/t8?,9-,10-,11-,13-/m1/s1 |
| InChIKey | IWMVZBJKXHNZDV-ZELGKILVSA-N |
| XLogP | -3.22 |
| TPSA | 246.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|