C13H20N4 — CID 87170150
N'-amino-1-benzyl-4-methylpyrrolidine-3-carboximidamide (PubChem CID 87170150) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is N'-amino-1-benzyl-4-methylpyrrolidine-3-carboximidamide.
| Compound Name | N'-amino-1-benzyl-4-methylpyrrolidine-3-carboximidamide |
|---|---|
| PubChem CID | 87170150 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | N'-amino-1-benzyl-4-methylpyrrolidine-3-carboximidamide |
| SMILES | CC1CN(Cc2ccccc2)CC1/C(N)=N/N |
| InChI | InChI=1S/C13H20N4/c1-10-7-17(9-12(10)13(14)16-15)8-11-5-3-2-4-6-11/h2-6,10,12H,7-9,15H2,1H3,(H2,14,16) |
| InChIKey | HLMNDSNNVZLVQS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|