C18H25NO8S — CID 87172896
methyl hydrogen sulfate;(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 3-hydroxy-2-phenylpropanoate (PubChem CID 87172896) has the molecular formula C18H25NO8S and a molecular weight of 415.46 g/mol. Its IUPAC name is methyl hydrogen sulfate;(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 3-hydroxy-2-phenylpropanoate.
| Compound Name | methyl hydrogen sulfate;(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 87172896 |
| Molecular Formula | C18H25NO8S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | methyl hydrogen sulfate;(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 3-hydroxy-2-phenylpropanoate |
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC12.COS(=O)(=O)O |
| InChI | InChI=1S/C17H21NO4.CH4O4S/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-6,11-16,19H,7-9H2,1H3;1H3,(H,2,3,4) |
| InChIKey | FJVPOWQZUQGGNZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|