C17H22N2O7 — CID 87374891
(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;nitric acid (PubChem CID 87374891) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is (9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;nitric acid.
| Compound Name | (9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;nitric acid |
|---|---|
| PubChem CID | 87374891 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) (2S)-3-hydroxy-2-phenylpropanoate;nitric acid |
| SMILES | CN1C2CC(OC(=O)[C@H](CO)c3ccccc3)CC1C1OC12.O=[N+]([O-])O |
| InChI | InChI=1S/C17H21NO4.HNO3/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;2-1(3)4/h2-6,11-16,19H,7-9H2,1H3;(H,2,3,4)/t11?,12-,13?,14?,15?,16?;/m1./s1 |
| InChIKey | VPYJVWUQKKGHAG-VTEZLSFDSA-N |
| XLogP | 0.57 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|