C21H24N6O4S — CID 87172983
3-[8-morpholin-4-yl-3-[4-(sulfonylmethyl)piperazin-1-yl]imidazo[1,2-a]pyrazin-6-yl]phenol (PubChem CID 87172983) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[8-morpholin-4-yl-3-[4-(sulfonylmethyl)piperazin-1-yl]imidazo[1,2-a]pyrazin-6-yl]phenol.
| Compound Name | 3-[8-morpholin-4-yl-3-[4-(sulfonylmethyl)piperazin-1-yl]imidazo[1,2-a]pyrazin-6-yl]phenol |
|---|---|
| PubChem CID | 87172983 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[8-morpholin-4-yl-3-[4-(sulfonylmethyl)piperazin-1-yl]imidazo[1,2-a]pyrazin-6-yl]phenol |
| SMILES | O=S(=O)=CN1CCN(c2cnc3c(N4CCOCC4)nc(-c4cccc(O)c4)cn23)CC1 |
| InChI | InChI=1S/C21H24N6O4S/c28-17-3-1-2-16(12-17)18-14-27-19(25-6-4-24(5-7-25)15-32(29)30)13-22-20(27)21(23-18)26-8-10-31-11-9-26/h1-3,12-15,28H,4-11H2 |
| InChIKey | GORBPSVZEBYHOU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|