C17H18N4O — CID 90084217
4-(3-methyl-6-phenylimidazo[1,2-a]pyrazin-8-yl)morpholine (PubChem CID 90084217) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-(3-methyl-6-phenylimidazo[1,2-a]pyrazin-8-yl)morpholine.
| Compound Name | 4-(3-methyl-6-phenylimidazo[1,2-a]pyrazin-8-yl)morpholine |
|---|---|
| PubChem CID | 90084217 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-(3-methyl-6-phenylimidazo[1,2-a]pyrazin-8-yl)morpholine |
| SMILES | Cc1cnc2c(N3CCOCC3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C17H18N4O/c1-13-11-18-16-17(20-7-9-22-10-8-20)19-15(12-21(13)16)14-5-3-2-4-6-14/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | RLEFBANKSYURTR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |