C18H22N8O3S — CID 52917534
5-(5-methylsulfonyl-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl)pyrimidin-2-amine (PubChem CID 52917534) has the molecular formula C18H22N8O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 5-(5-methylsulfonyl-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl)pyrimidin-2-amine.
| Compound Name | 5-(5-methylsulfonyl-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 52917534 |
| Molecular Formula | C18H22N8O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 5-(5-methylsulfonyl-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCc2c(nc3c(N4CCOCC4)nc(-c4cnc(N)nc4)cn23)C1 |
| InChI | InChI=1S/C18H22N8O3S/c1-30(27,28)25-3-2-15-14(10-25)23-17-16(24-4-6-29-7-5-24)22-13(11-26(15)17)12-8-20-18(19)21-9-12/h8-9,11H,2-7,10H2,1H3,(H2,19,20,21) |
| InChIKey | LIUSADRVCKXVIA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |