C26H38ClN5O2S — CID 87174928
N-[[4-[6,6-bis(methylamino)hexanoylamino]phenyl]carbamothioyl]-4-tert-butylbenzamide;hydrochloride (PubChem CID 87174928) has the molecular formula C26H38ClN5O2S and a molecular weight of 520.14 g/mol. Its IUPAC name is N-[[4-[6,6-bis(methylamino)hexanoylamino]phenyl]carbamothioyl]-4-tert-butylbenzamide;hydrochloride.
| Compound Name | N-[[4-[6,6-bis(methylamino)hexanoylamino]phenyl]carbamothioyl]-4-tert-butylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 87174928 |
| Molecular Formula | C26H38ClN5O2S |
| Molecular Weight | 520.14 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-[[4-[6,6-bis(methylamino)hexanoylamino]phenyl]carbamothioyl]-4-tert-butylbenzamide;hydrochloride |
| SMILES | CNC(CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)cc1)NC.Cl |
| InChI | InChI=1S/C26H37N5O2S.ClH/c1-26(2,3)19-12-10-18(11-13-19)24(33)31-25(34)30-21-16-14-20(15-17-21)29-23(32)9-7-6-8-22(27-4)28-5;/h10-17,22,27-28H,6-9H2,1-5H3,(H,29,32)(H2,30,31,33,34);1H |
| InChIKey | FFBFQWJBGUQVEO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.14 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|