C24H16F2N4S — CID 87176050
[3-(2-cyanophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]-methylcyanamide (PubChem CID 87176050) has the molecular formula C24H16F2N4S and a molecular weight of 430.48 g/mol. Its IUPAC name is [3-(2-cyanophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]-methylcyanamide.
| Compound Name | [3-(2-cyanophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]-methylcyanamide |
|---|---|
| PubChem CID | 87176050 |
| Molecular Formula | C24H16F2N4S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [3-(2-cyanophenyl)sulfanyl-1-[(3,5-difluorophenyl)methyl]indol-6-yl]-methylcyanamide |
| SMILES | CN(C#N)c1ccc2c(Sc3ccccc3C#N)cn(Cc3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C24H16F2N4S/c1-29(15-28)20-6-7-21-22(11-20)30(13-16-8-18(25)10-19(26)9-16)14-24(21)31-23-5-3-2-4-17(23)12-27/h2-11,14H,13H2,1H3 |
| InChIKey | FTGKBKBMZGRBPM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|