C24H16ClN5O3S — CID 87181084
N-[4-[5-(benzenesulfonyl)pyrrolo[2,3-b]pyrazin-7-yl]-6-chloro-2-pyridinyl]benzamide (PubChem CID 87181084) has the molecular formula C24H16ClN5O3S and a molecular weight of 489.94 g/mol. Its IUPAC name is N-[4-[5-(benzenesulfonyl)pyrrolo[2,3-b]pyrazin-7-yl]-6-chloro-2-pyridinyl]benzamide.
| Compound Name | N-[4-[5-(benzenesulfonyl)pyrrolo[2,3-b]pyrazin-7-yl]-6-chloro-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 87181084 |
| Molecular Formula | C24H16ClN5O3S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-[4-[5-(benzenesulfonyl)pyrrolo[2,3-b]pyrazin-7-yl]-6-chloro-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1cc(-c2cn(S(=O)(=O)c3ccccc3)c3nccnc23)cc(Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C24H16ClN5O3S/c25-20-13-17(14-21(28-20)29-24(31)16-7-3-1-4-8-16)19-15-30(23-22(19)26-11-12-27-23)34(32,33)18-9-5-2-6-10-18/h1-15H,(H,28,29,31) |
| InChIKey | FMOMYNUSURUJFH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|