C29H27ClN6O2S — CID 87192195
4-[5-(6-amino-3-pyridinyl)-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine (PubChem CID 87192195) has the molecular formula C29H27ClN6O2S and a molecular weight of 559.10 g/mol. Its IUPAC name is 4-[5-(6-amino-3-pyridinyl)-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine.
| Compound Name | 4-[5-(6-amino-3-pyridinyl)-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine |
|---|---|
| PubChem CID | 87192195 |
| Molecular Formula | C29H27ClN6O2S |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-[5-(6-amino-3-pyridinyl)-1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine |
| SMILES | Nc1ccc(-c2cnc3c(c2)c(-c2cc(Cl)nc(NC4CCCCC4)c2)cn3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C29H27ClN6O2S/c30-26-14-20(15-28(35-26)34-22-7-3-1-4-8-22)25-18-36(39(37,38)23-9-5-2-6-10-23)29-24(25)13-21(17-33-29)19-11-12-27(31)32-16-19/h2,5-6,9-18,22H,1,3-4,7-8H2,(H2,31,32)(H,34,35) |
| InChIKey | NOYNEKZBOZMBIE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|