C22H21ClN6 — CID 87191460
6-chloro-N-cyclohexyl-4-(5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 87191460) has the molecular formula C22H21ClN6 and a molecular weight of 404.91 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-4-(5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-cyclohexyl-4-(5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 87191460 |
| Molecular Formula | C22H21ClN6 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-chloro-N-cyclohexyl-4-(5-pyrimidin-5-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | Clc1cc(-c2c[nH]c3ncc(-c4cncnc4)cc23)cc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C22H21ClN6/c23-20-7-14(8-21(29-20)28-17-4-2-1-3-5-17)19-12-27-22-18(19)6-15(11-26-22)16-9-24-13-25-10-16/h6-13,17H,1-5H2,(H,26,27)(H,28,29) |
| InChIKey | XQDZAHJIGDOZJZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|