C21H22ClN5O — CID 87191625
4-N-[6-chloro-4-(5-prop-2-ynoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine (PubChem CID 87191625) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 4-N-[6-chloro-4-(5-prop-2-ynoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-chloro-4-(5-prop-2-ynoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 87191625 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-N-[6-chloro-4-(5-prop-2-ynoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]cyclohexane-1,4-diamine |
| SMILES | C#CCOc1cnc2[nH]cc(-c3cc(Cl)nc(NC4CCC(N)CC4)c3)c2c1 |
| InChI | InChI=1S/C21H22ClN5O/c1-2-7-28-16-10-17-18(12-25-21(17)24-11-16)13-8-19(22)27-20(9-13)26-15-5-3-14(23)4-6-15/h1,8-12,14-15H,3-7,23H2,(H,24,25)(H,26,27) |
| InChIKey | CBTAJDMIRCJVRL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|