C6H12F2N2O — CID 87182476
1-(difluoromethyl)-1,3-diethylurea (PubChem CID 87182476) has the molecular formula C6H12F2N2O and a molecular weight of 166.17 g/mol. Its IUPAC name is 1-(difluoromethyl)-1,3-diethylurea.
| Compound Name | 1-(difluoromethyl)-1,3-diethylurea |
|---|---|
| PubChem CID | 87182476 |
| Molecular Formula | C6H12F2N2O |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-(difluoromethyl)-1,3-diethylurea |
| SMILES | CCNC(=O)N(CC)C(F)F |
| InChI | InChI=1S/C6H12F2N2O/c1-3-9-6(11)10(4-2)5(7)8/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | PWELYVKYZHDQSS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|