About 1,3-diethylurea
1,3-diethylurea (PubChem CID 12194) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 1,3-diethylurea.
Molecular Properties
| Compound Name | 1,3-diethylurea |
| PubChem CID | 12194 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 1,3-diethylurea |
| SMILES | CCNC(=O)NCC |
| InChI | InChI=1S/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| InChIKey | ZWAVGZYKJNOTPX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethylurea?
The IUPAC name of 1,3-diethylurea (CID 12194) is 1,3-diethylurea.
What is the SMILES notation for 1,3-diethylurea?
The canonical SMILES for 1,3-diethylurea is CCNC(=O)NCC.
What is the InChIKey of 1,3-diethylurea?
The InChIKey is ZWAVGZYKJNOTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8).
What are the key properties of 1,3-diethylurea?
1,3-diethylurea has a molecular weight of 116.16 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethylurea is sourced from PubChem (CID 12194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).