C21H24N2O2S2 — CID 87184819
(4-methoxyphenyl)-[5-methyl-6-(2-morpholin-4-ylethyl)thieno[2,3-b]pyrrol-2-yl]methanethione (PubChem CID 87184819) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (4-methoxyphenyl)-[5-methyl-6-(2-morpholin-4-ylethyl)thieno[2,3-b]pyrrol-2-yl]methanethione.
| Compound Name | (4-methoxyphenyl)-[5-methyl-6-(2-morpholin-4-ylethyl)thieno[2,3-b]pyrrol-2-yl]methanethione |
|---|---|
| PubChem CID | 87184819 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (4-methoxyphenyl)-[5-methyl-6-(2-morpholin-4-ylethyl)thieno[2,3-b]pyrrol-2-yl]methanethione |
| SMILES | COc1ccc(C(=S)c2cc3cc(C)n(CCN4CCOCC4)c3s2)cc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-15-13-17-14-19(20(26)16-3-5-18(24-2)6-4-16)27-21(17)23(15)8-7-22-9-11-25-12-10-22/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | QMANGKPFEDOKJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|